C10H12N10O — CID 106412483
4-hydrazinyl-6-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3,5-triazin-2-amine (PubChem CID 106412483) has the molecular formula C10H12N10O and a molecular weight of 288.27 g/mol. Its IUPAC name is 4-hydrazinyl-6-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-6-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106412483 |
| Molecular Formula | C10H12N10O |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 4-hydrazinyl-6-imidazol-1-yl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1,3,5-triazin-2-amine |
| SMILES | NNc1nc(NCCc2ncno2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C10H12N10O/c11-19-9-16-8(13-2-1-7-14-5-15-21-7)17-10(18-9)20-4-3-12-6-20/h3-6H,1-2,11H2,(H2,13,16,17,18,19) |
| InChIKey | MZUFWHMNTDLPTE-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 145.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|