C10H20N6O3S — CID 80787221
N-[2-[[4-(methylamino)-6-propan-2-yloxy-1,3,5-triazin-2-yl]amino]ethyl]methanesulfonamide (PubChem CID 80787221) has the molecular formula C10H20N6O3S and a molecular weight of 304.38 g/mol. Its IUPAC name is N-[2-[[4-(methylamino)-6-propan-2-yloxy-1,3,5-triazin-2-yl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[4-(methylamino)-6-propan-2-yloxy-1,3,5-triazin-2-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 80787221 |
| Molecular Formula | C10H20N6O3S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-[2-[[4-(methylamino)-6-propan-2-yloxy-1,3,5-triazin-2-yl]amino]ethyl]methanesulfonamide |
| SMILES | CNc1nc(NCCNS(C)(=O)=O)nc(OC(C)C)n1 |
| InChI | InChI=1S/C10H20N6O3S/c1-7(2)19-10-15-8(11-3)14-9(16-10)12-5-6-13-20(4,17)18/h7,13H,5-6H2,1-4H3,(H2,11,12,14,15,16) |
| InChIKey | BNOTWAQTZNUSAG-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 118.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|