C10H17ClN4O3S — CID 62863284
4-chloro-N-(3-methylsulfonylpropyl)-6-propan-2-yloxy-1,3,5-triazin-2-amine (PubChem CID 62863284) has the molecular formula C10H17ClN4O3S and a molecular weight of 308.79 g/mol. Its IUPAC name is 4-chloro-N-(3-methylsulfonylpropyl)-6-propan-2-yloxy-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(3-methylsulfonylpropyl)-6-propan-2-yloxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62863284 |
| Molecular Formula | C10H17ClN4O3S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4-chloro-N-(3-methylsulfonylpropyl)-6-propan-2-yloxy-1,3,5-triazin-2-amine |
| SMILES | CC(C)Oc1nc(Cl)nc(NCCCS(C)(=O)=O)n1 |
| InChI | InChI=1S/C10H17ClN4O3S/c1-7(2)18-10-14-8(11)13-9(15-10)12-5-4-6-19(3,16)17/h7H,4-6H2,1-3H3,(H,12,13,14,15) |
| InChIKey | SOFKGOWMJVOHNJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|