C15H19ClN4O — CID 62863715
4-chloro-N-(3-phenylpropyl)-6-propan-2-yloxy-1,3,5-triazin-2-amine (PubChem CID 62863715) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is 4-chloro-N-(3-phenylpropyl)-6-propan-2-yloxy-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(3-phenylpropyl)-6-propan-2-yloxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62863715 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-chloro-N-(3-phenylpropyl)-6-propan-2-yloxy-1,3,5-triazin-2-amine |
| SMILES | CC(C)Oc1nc(Cl)nc(NCCCc2ccccc2)n1 |
| InChI | InChI=1S/C15H19ClN4O/c1-11(2)21-15-19-13(16)18-14(20-15)17-10-6-9-12-7-4-3-5-8-12/h3-5,7-8,11H,6,9-10H2,1-2H3,(H,17,18,19,20) |
| InChIKey | OMKJZNHIYULGCT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|