C9H18N6O2S — CID 106249098
1-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]-2-methyl-3-methylsulfanylpropan-2-ol (PubChem CID 106249098) has the molecular formula C9H18N6O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is 1-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]-2-methyl-3-methylsulfanylpropan-2-ol.
| Compound Name | 1-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]-2-methyl-3-methylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 106249098 |
| Molecular Formula | C9H18N6O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]-2-methyl-3-methylsulfanylpropan-2-ol |
| SMILES | COc1nc(NN)nc(NCC(C)(O)CSC)n1 |
| InChI | InChI=1S/C9H18N6O2S/c1-9(16,5-18-3)4-11-6-12-7(15-10)14-8(13-6)17-2/h16H,4-5,10H2,1-3H3,(H2,11,12,13,14,15) |
| InChIKey | FXUDBHHXPBVQLU-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|