C8H10BrF3N4O — CID 82793945
[5-bromo-4-(4,4,4-trifluorobutoxy)pyrimidin-2-yl]hydrazine (PubChem CID 82793945) has the molecular formula C8H10BrF3N4O and a molecular weight of 315.09 g/mol. Its IUPAC name is [5-bromo-4-(4,4,4-trifluorobutoxy)pyrimidin-2-yl]hydrazine.
| Compound Name | [5-bromo-4-(4,4,4-trifluorobutoxy)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 82793945 |
| Molecular Formula | C8H10BrF3N4O |
| Molecular Weight | 315.09 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | [5-bromo-4-(4,4,4-trifluorobutoxy)pyrimidin-2-yl]hydrazine |
| SMILES | NNc1ncc(Br)c(OCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H10BrF3N4O/c9-5-4-14-7(16-13)15-6(5)17-3-1-2-8(10,11)12/h4H,1-3,13H2,(H,14,15,16) |
| InChIKey | JUKXCHDYRUTCLW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.09 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|