C12H24N6O2 — CID 106358418
3-[(4-hydrazinyl-6-propoxy-1,3,5-triazin-2-yl)amino]-4-methylpentan-1-ol (PubChem CID 106358418) has the molecular formula C12H24N6O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-[(4-hydrazinyl-6-propoxy-1,3,5-triazin-2-yl)amino]-4-methylpentan-1-ol.
| Compound Name | 3-[(4-hydrazinyl-6-propoxy-1,3,5-triazin-2-yl)amino]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 106358418 |
| Molecular Formula | C12H24N6O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 3-[(4-hydrazinyl-6-propoxy-1,3,5-triazin-2-yl)amino]-4-methylpentan-1-ol |
| SMILES | CCCOc1nc(NN)nc(NC(CCO)C(C)C)n1 |
| InChI | InChI=1S/C12H24N6O2/c1-4-7-20-12-16-10(15-11(17-12)18-13)14-9(5-6-19)8(2)3/h8-9,19H,4-7,13H2,1-3H3,(H2,14,15,16,17,18) |
| InChIKey | XGLDOIYSCRDXJU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|