C15H17N5S — CID 56756516
6-(1-methylimidazol-2-yl)-N-(1-thiophen-3-ylpropan-2-yl)pyridazin-3-amine (PubChem CID 56756516) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is 6-(1-methylimidazol-2-yl)-N-(1-thiophen-3-ylpropan-2-yl)pyridazin-3-amine.
| Compound Name | 6-(1-methylimidazol-2-yl)-N-(1-thiophen-3-ylpropan-2-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 56756516 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 6-(1-methylimidazol-2-yl)-N-(1-thiophen-3-ylpropan-2-yl)pyridazin-3-amine |
| SMILES | CC(Cc1ccsc1)Nc1ccc(-c2nccn2C)nn1 |
| InChI | InChI=1S/C15H17N5S/c1-11(9-12-5-8-21-10-12)17-14-4-3-13(18-19-14)15-16-6-7-20(15)2/h3-8,10-11H,9H2,1-2H3,(H,17,19) |
| InChIKey | QSSSHVPZIJLNRN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |