C18H19N5 — CID 122557581
N-(1-benzylcyclopropyl)-6-(1-methylimidazol-2-yl)pyridazin-3-amine (PubChem CID 122557581) has the molecular formula C18H19N5 and a molecular weight of 305.39 g/mol. Its IUPAC name is N-(1-benzylcyclopropyl)-6-(1-methylimidazol-2-yl)pyridazin-3-amine.
| Compound Name | N-(1-benzylcyclopropyl)-6-(1-methylimidazol-2-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 122557581 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | N-(1-benzylcyclopropyl)-6-(1-methylimidazol-2-yl)pyridazin-3-amine |
| SMILES | Cn1ccnc1-c1ccc(NC2(Cc3ccccc3)CC2)nn1 |
| InChI | InChI=1S/C18H19N5/c1-23-12-11-19-17(23)15-7-8-16(22-21-15)20-18(9-10-18)13-14-5-3-2-4-6-14/h2-8,11-12H,9-10,13H2,1H3,(H,20,22) |
| InChIKey | PAABQCCZBWFKEG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |