C17H26N2O3S — CID 95773556
N-(5,5-dimethylhexyl)-N'-[3-[(S)-methylsulfinyl]phenyl]oxamide (PubChem CID 95773556) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is N-(5,5-dimethylhexyl)-N'-[3-[(S)-methylsulfinyl]phenyl]oxamide.
| Compound Name | N-(5,5-dimethylhexyl)-N'-[3-[(S)-methylsulfinyl]phenyl]oxamide |
|---|---|
| PubChem CID | 95773556 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-(5,5-dimethylhexyl)-N'-[3-[(S)-methylsulfinyl]phenyl]oxamide |
| SMILES | C[S@](=O)c1cccc(NC(=O)C(=O)NCCCCC(C)(C)C)c1 |
| InChI | InChI=1S/C17H26N2O3S/c1-17(2,3)10-5-6-11-18-15(20)16(21)19-13-8-7-9-14(12-13)23(4)22/h7-9,12H,5-6,10-11H2,1-4H3,(H,18,20)(H,19,21)/t23-/m0/s1 |
| InChIKey | QKKUIIXLWXOWEN-QHCPKHFHSA-N |
| XLogP | 2.70 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|