C14H15NO3 — CID 163743441
(2E,4Z)-N-(3-acetylphenyl)-5-hydroxy-2-methylpenta-2,4-dienamide (PubChem CID 163743441) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is (2E,4Z)-N-(3-acetylphenyl)-5-hydroxy-2-methylpenta-2,4-dienamide.
| Compound Name | (2E,4Z)-N-(3-acetylphenyl)-5-hydroxy-2-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 163743441 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (2E,4Z)-N-(3-acetylphenyl)-5-hydroxy-2-methylpenta-2,4-dienamide |
| SMILES | CC(=O)c1cccc(NC(=O)/C(C)=C/C=C\O)c1 |
| InChI | InChI=1S/C14H15NO3/c1-10(5-4-8-16)14(18)15-13-7-3-6-12(9-13)11(2)17/h3-9,16H,1-2H3,(H,15,18)/b8-4-,10-5+ |
| InChIKey | LJTGXBRQFHLJGK-HZEUFOEUSA-N |
| XLogP | 2.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|