C21H33N7O3 — CID 23758298
2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-morpholin-4-yl-4-N-(2-phenylethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 23758298) has the molecular formula C21H33N7O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-morpholin-4-yl-4-N-(2-phenylethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-morpholin-4-yl-4-N-(2-phenylethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23758298 |
| Molecular Formula | C21H33N7O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 2-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-morpholin-4-yl-4-N-(2-phenylethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | NCCOCCOCCNc1nc(NCCc2ccccc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C21H33N7O3/c22-7-12-29-16-17-30-13-9-24-20-25-19(23-8-6-18-4-2-1-3-5-18)26-21(27-20)28-10-14-31-15-11-28/h1-5H,6-17,22H2,(H2,23,24,25,26,27) |
| InChIKey | NILREOBFRZWFHN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 119.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|