C26H34N8O4 — CID 23956485
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-benzyl-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazin-2-amine (PubChem CID 23956485) has the molecular formula C26H34N8O4 and a molecular weight of 522.61 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-benzyl-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazin-2-amine.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-benzyl-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 23956485 |
| Molecular Formula | C26H34N8O4 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-benzyl-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazin-2-amine |
| SMILES | NCCOCCOCCNc1nc(Cc2ccccc2)nc(N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)n1 |
| InChI | InChI=1S/C26H34N8O4/c27-10-16-37-18-19-38-17-11-28-25-29-24(20-21-4-2-1-3-5-21)30-26(31-25)33-14-12-32(13-15-33)22-6-8-23(9-7-22)34(35)36/h1-9H,10-20,27H2,(H,28,29,30,31) |
| InChIKey | PSXPQQKKOFQNKG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 144.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|