C32H44N10O6 — CID 23872920
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4-[(4-hydroxycyclohexyl)amino]-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 23872920) has the molecular formula C32H44N10O6 and a molecular weight of 664.77 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4-[(4-hydroxycyclohexyl)amino]-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4-[(4-hydroxycyclohexyl)amino]-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 23872920 |
| Molecular Formula | C32H44N10O6 |
| Molecular Weight | 664.77 g/mol |
| Exact Mass | 664.34 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4-[(4-hydroxycyclohexyl)amino]-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | NCCOCCOCCNC(=O)c1ccc(Nc2nc(NC3CCC(O)CC3)nc(N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)n2)cc1 |
| InChI | InChI=1S/C32H44N10O6/c33-13-19-47-21-22-48-20-14-34-29(44)23-1-3-24(4-2-23)35-30-37-31(36-25-5-11-28(43)12-6-25)39-32(38-30)41-17-15-40(16-18-41)26-7-9-27(10-8-26)42(45)46/h1-4,7-10,25,28,43H,5-6,11-22,33H2,(H,34,44)(H2,35,36,37,38,39) |
| InChIKey | DVLZVUZTVODAOQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 206.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.77 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|