C26H36N6O5 — CID 23844770
4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-benzyl-2-N-[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 23844770) has the molecular formula C26H36N6O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-benzyl-2-N-[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-benzyl-2-N-[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23844770 |
| Molecular Formula | C26H36N6O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-benzyl-2-N-[(3,4,5-trimethoxyphenyl)methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COc1cc(CNc2nc(Cc3ccccc3)nc(NCCOCCOCCN)n2)cc(OC)c1OC |
| InChI | InChI=1S/C26H36N6O5/c1-33-21-15-20(16-22(34-2)24(21)35-3)18-29-26-31-23(17-19-7-5-4-6-8-19)30-25(32-26)28-10-12-37-14-13-36-11-9-27/h4-8,15-16H,9-14,17-18,27H2,1-3H3,(H2,28,29,30,31,32) |
| InChIKey | CTVAPWNSMBGNGT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|