C22H22ClF5N6O3 — CID 11421456
4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(3-chlorophenyl)methyl]-6-(2,3,4,5,6-pentafluorophenoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 11421456) has the molecular formula C22H22ClF5N6O3 and a molecular weight of 548.90 g/mol. Its IUPAC name is 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(3-chlorophenyl)methyl]-6-(2,3,4,5,6-pentafluorophenoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(3-chlorophenyl)methyl]-6-(2,3,4,5,6-pentafluorophenoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 11421456 |
| Molecular Formula | C22H22ClF5N6O3 |
| Molecular Weight | 548.90 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(3-chlorophenyl)methyl]-6-(2,3,4,5,6-pentafluorophenoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | NCCOCCOCCNc1nc(NCc2cccc(Cl)c2)nc(Oc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C22H22ClF5N6O3/c23-13-3-1-2-12(10-13)11-31-21-32-20(30-5-7-36-9-8-35-6-4-29)33-22(34-21)37-19-17(27)15(25)14(24)16(26)18(19)28/h1-3,10H,4-9,11,29H2,(H2,30,31,32,33,34) |
| InChIKey | AYUNBKAHGOJHOH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.90 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|