C22H26N6O — CID 166243447
2-[4-[4-(benzylamino)quinazolin-2-yl]-1,4-diazepan-1-yl]acetamide (PubChem CID 166243447) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-[4-[4-(benzylamino)quinazolin-2-yl]-1,4-diazepan-1-yl]acetamide.
| Compound Name | 2-[4-[4-(benzylamino)quinazolin-2-yl]-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 166243447 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-[4-[4-(benzylamino)quinazolin-2-yl]-1,4-diazepan-1-yl]acetamide |
| SMILES | NC(=O)CN1CCCN(c2nc(NCc3ccccc3)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C22H26N6O/c23-20(29)16-27-11-6-12-28(14-13-27)22-25-19-10-5-4-9-18(19)21(26-22)24-15-17-7-2-1-3-8-17/h1-5,7-10H,6,11-16H2,(H2,23,29)(H,24,25,26) |
| InChIKey | LVQDQWCWYDDDAK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |