C21H25N5O2S — CID 25144317
N-benzyl-2-(4-ethylsulfonylpiperazin-1-yl)quinazolin-4-amine (PubChem CID 25144317) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is N-benzyl-2-(4-ethylsulfonylpiperazin-1-yl)quinazolin-4-amine.
| Compound Name | N-benzyl-2-(4-ethylsulfonylpiperazin-1-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 25144317 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-benzyl-2-(4-ethylsulfonylpiperazin-1-yl)quinazolin-4-amine |
| SMILES | CCS(=O)(=O)N1CCN(c2nc(NCc3ccccc3)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C21H25N5O2S/c1-2-29(27,28)26-14-12-25(13-15-26)21-23-19-11-7-6-10-18(19)20(24-21)22-16-17-8-4-3-5-9-17/h3-11H,2,12-16H2,1H3,(H,22,23,24) |
| InChIKey | LLNHXFHKQAGFMZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |