C24H20N4O — CID 71139640
N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine (PubChem CID 71139640) has the molecular formula C24H20N4O and a molecular weight of 380.45 g/mol. Its IUPAC name is N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine.
| Compound Name | N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine |
|---|---|
| PubChem CID | 71139640 |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine |
| SMILES | COc1ccc2nc(Nc3ccc(Cc4ccccc4)cc3)c3[nH]ncc3c2c1 |
| InChI | InChI=1S/C24H20N4O/c1-29-19-11-12-22-20(14-19)21-15-25-28-23(21)24(27-22)26-18-9-7-17(8-10-18)13-16-5-3-2-4-6-16/h2-12,14-15H,13H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | ZEMQDZPLVZSVTQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |