About N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine
N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine (PubChem CID 71139640) has the molecular formula C24H20N4O
and a molecular weight of 380.45 g/mol. Its IUPAC name is N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine.
Molecular Properties
| Compound Name | N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine |
| PubChem CID | 71139640 |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine |
| SMILES | COc1ccc2nc(Nc3ccc(Cc4ccccc4)cc3)c3[nH]ncc3c2c1 |
| InChI | InChI=1S/C24H20N4O/c1-29-19-11-12-22-20(14-19)21-15-25-28-23(21)24(27-22)26-18-9-7-17(8-10-18)13-16-5-3-2-4-6-16/h2-12,14-15H,13H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | ZEMQDZPLVZSVTQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine?
The IUPAC name of N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine (CID 71139640) is N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine.
What is the SMILES notation for N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine?
The canonical SMILES for N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine is COc1ccc2nc(Nc3ccc(Cc4ccccc4)cc3)c3[nH]ncc3c2c1.
What is the InChIKey of N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine?
The InChIKey is ZEMQDZPLVZSVTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N4O/c1-29-19-11-12-22-20(14-19)21-15-25-28-23(21)24(27-22)26-18-9-7-17(8-10-18)13-16-5-3-2-4-6-16/h2-12,14-15H,13H2,1H3,(H,25,28)(H,26,27).
What are the key properties of N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine?
N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine has a molecular weight of 380.45 g/mol, XLogP of 5.45, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-benzylphenyl)-8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-amine is sourced from PubChem (CID 71139640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).