C25H26N6O2 — CID 59023071
4-[3-ethyl-8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-5-yl]benzamide (PubChem CID 59023071) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-[3-ethyl-8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-5-yl]benzamide.
| Compound Name | 4-[3-ethyl-8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-5-yl]benzamide |
|---|---|
| PubChem CID | 59023071 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 4-[3-ethyl-8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-5-yl]benzamide |
| SMILES | CCc1cnc2c(Nc3ccc(N4CCOCC4)cc3)ncc(-c3ccc(C(N)=O)cc3)n12 |
| InChI | InChI=1S/C25H26N6O2/c1-2-20-15-28-25-24(29-19-7-9-21(10-8-19)30-11-13-33-14-12-30)27-16-22(31(20)25)17-3-5-18(6-4-17)23(26)32/h3-10,15-16H,2,11-14H2,1H3,(H2,26,32)(H,27,29) |
| InChIKey | IBJYUKNZJAVWPR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|