C34H39F2N7O4 — CID 138576545
tert-butyl 4-[2-cyano-4-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-4-yl]phenoxy]-3,3-difluoropiperidine-1-carboxylate (PubChem CID 138576545) has the molecular formula C34H39F2N7O4 and a molecular weight of 647.73 g/mol. Its IUPAC name is tert-butyl 4-[2-cyano-4-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-4-yl]phenoxy]-3,3-difluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-cyano-4-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-4-yl]phenoxy]-3,3-difluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 138576545 |
| Molecular Formula | C34H39F2N7O4 |
| Molecular Weight | 647.73 g/mol |
| Exact Mass | 647.30 |
| IUPAC Name | tert-butyl 4-[2-cyano-4-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-4-yl]phenoxy]-3,3-difluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(-c3ccnc(Nc4ccc(N5CCN(C6COC6)CC5)cc4)n3)cc2C#N)C(F)(F)C1 |
| InChI | InChI=1S/C34H39F2N7O4/c1-33(2,3)47-32(44)43-13-11-30(34(35,36)22-43)46-29-9-4-23(18-24(29)19-37)28-10-12-38-31(40-28)39-25-5-7-26(8-6-25)41-14-16-42(17-15-41)27-20-45-21-27/h4-10,12,18,27,30H,11,13-17,20-22H2,1-3H3,(H,38,39,40) |
| InChIKey | DTJLPPHAWABMPS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.73 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|