C23H27N5O3S — CID 71025276
N-[4-[2-[4-[4-(hydroxymethyl)piperidin-1-yl]anilino]pyrimidin-4-yl]phenyl]methanesulfonamide (PubChem CID 71025276) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is N-[4-[2-[4-[4-(hydroxymethyl)piperidin-1-yl]anilino]pyrimidin-4-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-[4-[4-(hydroxymethyl)piperidin-1-yl]anilino]pyrimidin-4-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 71025276 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-[4-[2-[4-[4-(hydroxymethyl)piperidin-1-yl]anilino]pyrimidin-4-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2ccnc(Nc3ccc(N4CCC(CO)CC4)cc3)n2)cc1 |
| InChI | InChI=1S/C23H27N5O3S/c1-32(30,31)27-20-4-2-18(3-5-20)22-10-13-24-23(26-22)25-19-6-8-21(9-7-19)28-14-11-17(16-29)12-15-28/h2-10,13,17,27,29H,11-12,14-16H2,1H3,(H,24,25,26) |
| InChIKey | NAPLDPRMDLWTNL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|