C27H32N6O3 — CID 69052159
(2S)-N-(2-hydroxyethyl)-1-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 69052159) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is (2S)-N-(2-hydroxyethyl)-1-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(2-hydroxyethyl)-1-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 69052159 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | (2S)-N-(2-hydroxyethyl)-1-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCO)[C@@H]1CCCN1c1ccc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C27H32N6O3/c34-17-13-28-26(35)25-2-1-14-33(25)23-7-3-20(4-8-23)24-11-12-29-27(31-24)30-21-5-9-22(10-6-21)32-15-18-36-19-16-32/h3-12,25,34H,1-2,13-19H2,(H,28,35)(H,29,30,31)/t25-/m0/s1 |
| InChIKey | XBXVSVQVWKGHPU-VWLOTQADSA-N |
| XLogP | 2.80 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|