C28H34N8O2 — CID 69023726
(2R)-1-[4-[2-[4-[4-[(2S)-2-aminopropanoyl]piperazin-1-yl]anilino]pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 69023726) has the molecular formula C28H34N8O2 and a molecular weight of 514.63 g/mol. Its IUPAC name is (2R)-1-[4-[2-[4-[4-[(2S)-2-aminopropanoyl]piperazin-1-yl]anilino]pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[4-[2-[4-[4-[(2S)-2-aminopropanoyl]piperazin-1-yl]anilino]pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 69023726 |
| Molecular Formula | C28H34N8O2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | (2R)-1-[4-[2-[4-[4-[(2S)-2-aminopropanoyl]piperazin-1-yl]anilino]pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | C[C@H](N)C(=O)N1CCN(c2ccc(Nc3nccc(-c4ccc(N5CCC[C@@H]5C(N)=O)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C28H34N8O2/c1-19(29)27(38)35-17-15-34(16-18-35)22-10-6-21(7-11-22)32-28-31-13-12-24(33-28)20-4-8-23(9-5-20)36-14-2-3-25(36)26(30)37/h4-13,19,25H,2-3,14-18,29H2,1H3,(H2,30,37)(H,31,32,33)/t19-,25+/m0/s1 |
| InChIKey | SZYABFIZWUBZSF-UQBPGWFLSA-N |
| XLogP | 2.34 |
| TPSA | 133.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|