C34H38N6O4S — CID 171349109
(E)-N-hydroxy-4-[4-[2-[1-[4-[[4-[4-(methanesulfonamido)phenyl]pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]ethyl]phenyl]but-3-enamide (PubChem CID 171349109) has the molecular formula C34H38N6O4S and a molecular weight of 626.78 g/mol. Its IUPAC name is (E)-N-hydroxy-4-[4-[2-[1-[4-[[4-[4-(methanesulfonamido)phenyl]pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]ethyl]phenyl]but-3-enamide.
| Compound Name | (E)-N-hydroxy-4-[4-[2-[1-[4-[[4-[4-(methanesulfonamido)phenyl]pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]ethyl]phenyl]but-3-enamide |
|---|---|
| PubChem CID | 171349109 |
| Molecular Formula | C34H38N6O4S |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | (E)-N-hydroxy-4-[4-[2-[1-[4-[[4-[4-(methanesulfonamido)phenyl]pyrimidin-2-yl]amino]phenyl]piperidin-4-yl]ethyl]phenyl]but-3-enamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2ccnc(Nc3ccc(N4CCC(CCc5ccc(/C=C/CC(=O)NO)cc5)CC4)cc3)n2)cc1 |
| InChI | InChI=1S/C34H38N6O4S/c1-45(43,44)39-30-13-11-28(12-14-30)32-19-22-35-34(37-32)36-29-15-17-31(18-16-29)40-23-20-27(21-24-40)10-9-26-7-5-25(6-8-26)3-2-4-33(41)38-42/h2-3,5-8,11-19,22,27,39,42H,4,9-10,20-21,23-24H2,1H3,(H,38,41)(H,35,36,37)/b3-2+ |
| InChIKey | HCBAGPOEIWZQBJ-NSCUHMNNSA-N |
| XLogP | 6.02 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|