C30H38N8O — CID 69023246
N-[4-[2-[4-[4-(pyrrolidin-2-ylmethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 69023246) has the molecular formula C30H38N8O and a molecular weight of 526.69 g/mol. Its IUPAC name is N-[4-[2-[4-[4-(pyrrolidin-2-ylmethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[4-[2-[4-[4-(pyrrolidin-2-ylmethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 69023246 |
| Molecular Formula | C30H38N8O |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | N-[4-[2-[4-[4-(pyrrolidin-2-ylmethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2ccnc(Nc3ccc(N4CCN(CC5CCCN5)CC4)cc3)n2)cc1)C1CCCN1 |
| InChI | InChI=1S/C30H38N8O/c39-29(28-4-2-15-32-28)34-23-7-5-22(6-8-23)27-13-16-33-30(36-27)35-24-9-11-26(12-10-24)38-19-17-37(18-20-38)21-25-3-1-14-31-25/h5-13,16,25,28,31-32H,1-4,14-15,17-21H2,(H,34,39)(H,33,35,36) |
| InChIKey | GLTNLWNAAPNAGB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|