C21H22BrN7O2 — CID 71058230
5-bromo-4-N-[5-(2,3-dihydrofuran-5-yl)-1H-pyrazol-3-yl]-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 71058230) has the molecular formula C21H22BrN7O2 and a molecular weight of 484.36 g/mol. Its IUPAC name is 5-bromo-4-N-[5-(2,3-dihydrofuran-5-yl)-1H-pyrazol-3-yl]-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-4-N-[5-(2,3-dihydrofuran-5-yl)-1H-pyrazol-3-yl]-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 71058230 |
| Molecular Formula | C21H22BrN7O2 |
| Molecular Weight | 484.36 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 5-bromo-4-N-[5-(2,3-dihydrofuran-5-yl)-1H-pyrazol-3-yl]-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | Brc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1Nc1cc(C2=CCCO2)[nH]n1 |
| InChI | InChI=1S/C21H22BrN7O2/c22-16-13-23-21(24-14-3-5-15(6-4-14)29-7-10-30-11-8-29)26-20(16)25-19-12-17(27-28-19)18-2-1-9-31-18/h2-6,12-13H,1,7-11H2,(H3,23,24,25,26,27,28) |
| InChIKey | JVWUEIYSQHOTIP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 100.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|