C18H19BrN4O — CID 68613505
4-bromo-N-(4-morpholin-4-ylphenyl)-7,8-dihydro-2,7-naphthyridin-1-amine (PubChem CID 68613505) has the molecular formula C18H19BrN4O and a molecular weight of 387.28 g/mol. Its IUPAC name is 4-bromo-N-(4-morpholin-4-ylphenyl)-7,8-dihydro-2,7-naphthyridin-1-amine.
| Compound Name | 4-bromo-N-(4-morpholin-4-ylphenyl)-7,8-dihydro-2,7-naphthyridin-1-amine |
|---|---|
| PubChem CID | 68613505 |
| Molecular Formula | C18H19BrN4O |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 4-bromo-N-(4-morpholin-4-ylphenyl)-7,8-dihydro-2,7-naphthyridin-1-amine |
| SMILES | Brc1cnc(Nc2ccc(N3CCOCC3)cc2)c2c1C=CNC2 |
| InChI | InChI=1S/C18H19BrN4O/c19-17-12-21-18(16-11-20-6-5-15(16)17)22-13-1-3-14(4-2-13)23-7-9-24-10-8-23/h1-6,12,20H,7-11H2,(H,21,22) |
| InChIKey | YYESUIDKBTURIY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|