C23H24N6O2 — CID 68612814
3-(6-methoxypyrimidin-4-yl)-N-(4-morpholin-4-ylphenyl)-7,8-dihydro-2,7-naphthyridin-1-amine (PubChem CID 68612814) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 3-(6-methoxypyrimidin-4-yl)-N-(4-morpholin-4-ylphenyl)-7,8-dihydro-2,7-naphthyridin-1-amine.
| Compound Name | 3-(6-methoxypyrimidin-4-yl)-N-(4-morpholin-4-ylphenyl)-7,8-dihydro-2,7-naphthyridin-1-amine |
|---|---|
| PubChem CID | 68612814 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 3-(6-methoxypyrimidin-4-yl)-N-(4-morpholin-4-ylphenyl)-7,8-dihydro-2,7-naphthyridin-1-amine |
| SMILES | COc1cc(-c2cc3c(c(Nc4ccc(N5CCOCC5)cc4)n2)CNC=C3)ncn1 |
| InChI | InChI=1S/C23H24N6O2/c1-30-22-13-20(25-15-26-22)21-12-16-6-7-24-14-19(16)23(28-21)27-17-2-4-18(5-3-17)29-8-10-31-11-9-29/h2-7,12-13,15,24H,8-11,14H2,1H3,(H,27,28) |
| InChIKey | GDDCGTMTWZVXEN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|