C21H22N6OS — CID 87514716
4-[1-(4-morpholin-4-ylanilino)-7,8-dihydro-2,7-naphthyridin-3-yl]-1,3-thiazol-2-amine (PubChem CID 87514716) has the molecular formula C21H22N6OS and a molecular weight of 406.52 g/mol. Its IUPAC name is 4-[1-(4-morpholin-4-ylanilino)-7,8-dihydro-2,7-naphthyridin-3-yl]-1,3-thiazol-2-amine.
| Compound Name | 4-[1-(4-morpholin-4-ylanilino)-7,8-dihydro-2,7-naphthyridin-3-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87514716 |
| Molecular Formula | C21H22N6OS |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 4-[1-(4-morpholin-4-ylanilino)-7,8-dihydro-2,7-naphthyridin-3-yl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2cc3c(c(Nc4ccc(N5CCOCC5)cc4)n2)CNC=C3)cs1 |
| InChI | InChI=1S/C21H22N6OS/c22-21-26-19(13-29-21)18-11-14-5-6-23-12-17(14)20(25-18)24-15-1-3-16(4-2-15)27-7-9-28-10-8-27/h1-6,11,13,23H,7-10,12H2,(H2,22,26)(H,24,25) |
| InChIKey | NRGGOETWYLNHGJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|