C21H20ClFN6O2 — CID 90667141
2-[[5-chloro-2-(3-fluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]benzamide (PubChem CID 90667141) has the molecular formula C21H20ClFN6O2 and a molecular weight of 442.88 g/mol. Its IUPAC name is 2-[[5-chloro-2-(3-fluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]benzamide.
| Compound Name | 2-[[5-chloro-2-(3-fluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 90667141 |
| Molecular Formula | C21H20ClFN6O2 |
| Molecular Weight | 442.88 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-[[5-chloro-2-(3-fluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1Nc1nc(Nc2ccc(N3CCOCC3)c(F)c2)ncc1Cl |
| InChI | InChI=1S/C21H20ClFN6O2/c22-15-12-25-21(28-20(15)27-17-4-2-1-3-14(17)19(24)30)26-13-5-6-18(16(23)11-13)29-7-9-31-10-8-29/h1-6,11-12H,7-10H2,(H2,24,30)(H2,25,26,27,28) |
| InChIKey | CURYPDOOWVGYCW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|