C27H33N5O3S2 — CID 138721367
1-[4-[[4-[[(3E,5Z)-2-propan-2-ylsulfonylhepta-1,3,5-trien-3-yl]amino]thieno[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol (PubChem CID 138721367) has the molecular formula C27H33N5O3S2 and a molecular weight of 539.73 g/mol. Its IUPAC name is 1-[4-[[4-[[(3E,5Z)-2-propan-2-ylsulfonylhepta-1,3,5-trien-3-yl]amino]thieno[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol.
| Compound Name | 1-[4-[[4-[[(3E,5Z)-2-propan-2-ylsulfonylhepta-1,3,5-trien-3-yl]amino]thieno[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 138721367 |
| Molecular Formula | C27H33N5O3S2 |
| Molecular Weight | 539.73 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 1-[4-[[4-[[(3E,5Z)-2-propan-2-ylsulfonylhepta-1,3,5-trien-3-yl]amino]thieno[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol |
| SMILES | C=C(/C(=C\C=C/C)Nc1nc(Nc2ccc(N3CCC(O)CC3)cc2)nc2ccsc12)S(=O)(=O)C(C)C |
| InChI | InChI=1S/C27H33N5O3S2/c1-5-6-7-23(19(4)37(34,35)18(2)3)29-26-25-24(14-17-36-25)30-27(31-26)28-20-8-10-21(11-9-20)32-15-12-22(33)13-16-32/h5-11,14,17-18,22,33H,4,12-13,15-16H2,1-3H3,(H2,28,29,30,31)/b6-5-,23-7+ |
| InChIKey | OXZHKDJOKGNOMW-ODWQCUNNSA-N |
| XLogP | 5.60 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.73 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|