C27H35N6PS — CID 142284863
4-N-[(3Z)-4-diethylphosphanylhexa-1,3,5-trien-3-yl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 142284863) has the molecular formula C27H35N6PS and a molecular weight of 506.66 g/mol. Its IUPAC name is 4-N-[(3Z)-4-diethylphosphanylhexa-1,3,5-trien-3-yl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[(3Z)-4-diethylphosphanylhexa-1,3,5-trien-3-yl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 142284863 |
| Molecular Formula | C27H35N6PS |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 4-N-[(3Z)-4-diethylphosphanylhexa-1,3,5-trien-3-yl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | C=C/C(Nc1nc(Nc2ccc(N3CCN(C)CC3)cc2)nc2ccsc12)=C(\C=C)P(CC)CC |
| InChI | InChI=1S/C27H35N6PS/c1-6-22(24(7-2)34(8-3)9-4)29-26-25-23(14-19-35-25)30-27(31-26)28-20-10-12-21(13-11-20)33-17-15-32(5)16-18-33/h6-7,10-14,19H,1-2,8-9,15-18H2,3-5H3,(H2,28,29,30,31)/b24-22- |
| InChIKey | UJZSWSZPEGBHAH-GYHWCHFESA-N |
| XLogP | 6.70 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|