C34H47N7OS — CID 69477168
(1R,2R,3R,5R)-2-[[2-[4-(4-cyclohexylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide (PubChem CID 69477168) has the molecular formula C34H47N7OS and a molecular weight of 601.87 g/mol. Its IUPAC name is (1R,2R,3R,5R)-2-[[2-[4-(4-cyclohexylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide.
| Compound Name | (1R,2R,3R,5R)-2-[[2-[4-(4-cyclohexylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 69477168 |
| Molecular Formula | C34H47N7OS |
| Molecular Weight | 601.87 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | (1R,2R,3R,5R)-2-[[2-[4-(4-cyclohexylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide |
| SMILES | CNC(=O)[C@@H]1C[C@H]2C[C@H](C2(C)C)[C@@]1(C)Nc1nc(Nc2ccc(N3CCN(C4CCCCC4)CC3)cc2)nc2ccsc12 |
| InChI | InChI=1S/C34H47N7OS/c1-33(2)22-20-26(31(42)35-4)34(3,28(33)21-22)39-30-29-27(14-19-43-29)37-32(38-30)36-23-10-12-25(13-11-23)41-17-15-40(16-18-41)24-8-6-5-7-9-24/h10-14,19,22,24,26,28H,5-9,15-18,20-21H2,1-4H3,(H,35,42)(H2,36,37,38,39)/t22-,26-,28+,34-/m0/s1 |
| InChIKey | HGUZNMOMWFNAIA-QOTBAICYSA-N |
| XLogP | 6.49 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.87 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|