C27H38ClN7O — CID 24984338
(1R,2R,3S,5S)-2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide (PubChem CID 24984338) has the molecular formula C27H38ClN7O and a molecular weight of 512.10 g/mol. Its IUPAC name is (1R,2R,3S,5S)-2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide.
| Compound Name | (1R,2R,3S,5S)-2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 24984338 |
| Molecular Formula | C27H38ClN7O |
| Molecular Weight | 512.10 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | (1R,2R,3S,5S)-2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide |
| SMILES | CNC(=O)[C@H]1C[C@@H]2C[C@H](C2(C)C)[C@@]1(C)Nc1nc(Nc2ccc(N3CCN(C)CC3)cc2)ncc1Cl |
| InChI | InChI=1S/C27H38ClN7O/c1-26(2)17-14-20(24(36)29-4)27(3,22(26)15-17)33-23-21(28)16-30-25(32-23)31-18-6-8-19(9-7-18)35-12-10-34(5)11-13-35/h6-9,16-17,20,22H,10-15H2,1-5H3,(H,29,36)(H2,30,31,32,33)/t17-,20-,22-,27+/m1/s1 |
| InChIKey | BEXLCMQPDJUILP-ZTTZPIBDSA-N |
| XLogP | 4.22 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.10 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|