C30H43ClN6O2 — CID 66658803
(1R,2R,3S,5R)-2-[[5-chloro-2-[4-(2-pyrrolidin-1-ylethoxy)anilino]pyrimidin-4-yl]amino]-2,6,6-trimethyl-N-propan-2-ylbicyclo[3.1.1]heptane-3-carboxamide (PubChem CID 66658803) has the molecular formula C30H43ClN6O2 and a molecular weight of 555.17 g/mol. Its IUPAC name is (1R,2R,3S,5R)-2-[[5-chloro-2-[4-(2-pyrrolidin-1-ylethoxy)anilino]pyrimidin-4-yl]amino]-2,6,6-trimethyl-N-propan-2-ylbicyclo[3.1.1]heptane-3-carboxamide.
| Compound Name | (1R,2R,3S,5R)-2-[[5-chloro-2-[4-(2-pyrrolidin-1-ylethoxy)anilino]pyrimidin-4-yl]amino]-2,6,6-trimethyl-N-propan-2-ylbicyclo[3.1.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 66658803 |
| Molecular Formula | C30H43ClN6O2 |
| Molecular Weight | 555.17 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | (1R,2R,3S,5R)-2-[[5-chloro-2-[4-(2-pyrrolidin-1-ylethoxy)anilino]pyrimidin-4-yl]amino]-2,6,6-trimethyl-N-propan-2-ylbicyclo[3.1.1]heptane-3-carboxamide |
| SMILES | CC(C)NC(=O)[C@H]1C[C@H]2C[C@H](C2(C)C)[C@@]1(C)Nc1nc(Nc2ccc(OCCN3CCCC3)cc2)ncc1Cl |
| InChI | InChI=1S/C30H43ClN6O2/c1-19(2)33-27(38)23-16-20-17-25(29(20,3)4)30(23,5)36-26-24(31)18-32-28(35-26)34-21-8-10-22(11-9-21)39-15-14-37-12-6-7-13-37/h8-11,18-20,23,25H,6-7,12-17H2,1-5H3,(H,33,38)(H2,32,34,35,36)/t20-,23+,25+,30-/m0/s1 |
| InChIKey | JBHXDJYYCLKQCD-LUHYLGFGSA-N |
| XLogP | 5.73 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.17 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |