C28H40ClN7O — CID 66658952
(1R,2R,3S,5R)-2-[[5-chloro-2-[[1-[2-(dimethylamino)ethyl]-2,3-dihydroindol-5-yl]amino]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide (PubChem CID 66658952) has the molecular formula C28H40ClN7O and a molecular weight of 526.13 g/mol. Its IUPAC name is (1R,2R,3S,5R)-2-[[5-chloro-2-[[1-[2-(dimethylamino)ethyl]-2,3-dihydroindol-5-yl]amino]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide.
| Compound Name | (1R,2R,3S,5R)-2-[[5-chloro-2-[[1-[2-(dimethylamino)ethyl]-2,3-dihydroindol-5-yl]amino]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide |
|---|---|
| PubChem CID | 66658952 |
| Molecular Formula | C28H40ClN7O |
| Molecular Weight | 526.13 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | (1R,2R,3S,5R)-2-[[5-chloro-2-[[1-[2-(dimethylamino)ethyl]-2,3-dihydroindol-5-yl]amino]pyrimidin-4-yl]amino]-N,2,6,6-tetramethylbicyclo[3.1.1]heptane-3-carboxamide |
| SMILES | CNC(=O)[C@H]1C[C@H]2C[C@H](C2(C)C)[C@@]1(C)Nc1nc(Nc2ccc3c(c2)CCN3CCN(C)C)ncc1Cl |
| InChI | InChI=1S/C28H40ClN7O/c1-27(2)18-14-20(25(37)30-4)28(3,23(27)15-18)34-24-21(29)16-31-26(33-24)32-19-7-8-22-17(13-19)9-10-36(22)12-11-35(5)6/h7-8,13,16,18,20,23H,9-12,14-15H2,1-6H3,(H,30,37)(H2,31,32,33,34)/t18-,20+,23+,28-/m0/s1 |
| InChIKey | NQJBUFZLYYOQFZ-HMVCEBKCSA-N |
| XLogP | 4.40 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.13 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|