C24H32ClF3N6O3S — CID 67264155
N-[(1R,2R)-2-[[5-chloro-2-[[3-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonamide (PubChem CID 67264155) has the molecular formula C24H32ClF3N6O3S and a molecular weight of 577.07 g/mol. Its IUPAC name is N-[(1R,2R)-2-[[5-chloro-2-[[3-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonamide.
| Compound Name | N-[(1R,2R)-2-[[5-chloro-2-[[3-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 67264155 |
| Molecular Formula | C24H32ClF3N6O3S |
| Molecular Weight | 577.07 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | N-[(1R,2R)-2-[[5-chloro-2-[[3-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CCCC[C@H]1Nc1nc(Nc2ccc3c(c2)CCN(CC(O)C(F)(F)F)CC3)ncc1Cl |
| InChI | InChI=1S/C24H32ClF3N6O3S/c1-38(36,37)33-20-5-3-2-4-19(20)31-22-18(25)13-29-23(32-22)30-17-7-6-15-8-10-34(11-9-16(15)12-17)14-21(35)24(26,27)28/h6-7,12-13,19-21,33,35H,2-5,8-11,14H2,1H3,(H2,29,30,31,32)/t19-,20-,21?/m1/s1 |
| InChIKey | IHNMDFSBTNABLD-OSBQEZSISA-N |
| XLogP | 3.47 |
| TPSA | 119.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.07 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |