C27H39ClN6O5S — CID 87330278
1-[(1R,2R)-1-carbamoyl-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]propane-2-sulfonic acid (PubChem CID 87330278) has the molecular formula C27H39ClN6O5S and a molecular weight of 595.17 g/mol. Its IUPAC name is 1-[(1R,2R)-1-carbamoyl-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]propane-2-sulfonic acid.
| Compound Name | 1-[(1R,2R)-1-carbamoyl-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]propane-2-sulfonic acid |
|---|---|
| PubChem CID | 87330278 |
| Molecular Formula | C27H39ClN6O5S |
| Molecular Weight | 595.17 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | 1-[(1R,2R)-1-carbamoyl-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]propane-2-sulfonic acid |
| SMILES | COCCN1CCc2ccc(Nc3ncc(Cl)c(N[C@@H]4CCCC[C@]4(CC(C)S(=O)(=O)O)C(N)=O)n3)cc2CC1 |
| InChI | InChI=1S/C27H39ClN6O5S/c1-18(40(36,37)38)16-27(25(29)35)10-4-3-5-23(27)32-24-22(28)17-30-26(33-24)31-21-7-6-19-8-11-34(13-14-39-2)12-9-20(19)15-21/h6-7,15,17-18,23H,3-5,8-14,16H2,1-2H3,(H2,29,35)(H,36,37,38)(H2,30,31,32,33)/t18?,23-,27-/m1/s1 |
| InChIKey | AXGSNYPEEFXQMP-HJWKCDTESA-N |
| XLogP | 3.41 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|