C25H37ClN6O4S — CID 118272683
8-[[5-chloro-4-[[(1R,2R)-2-[(sulfinoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-7-methoxy-3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 118272683) has the molecular formula C25H37ClN6O4S and a molecular weight of 553.13 g/mol. Its IUPAC name is 8-[[5-chloro-4-[[(1R,2R)-2-[(sulfinoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-7-methoxy-3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 8-[[5-chloro-4-[[(1R,2R)-2-[(sulfinoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-7-methoxy-3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 118272683 |
| Molecular Formula | C25H37ClN6O4S |
| Molecular Weight | 553.13 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 8-[[5-chloro-4-[[(1R,2R)-2-[(sulfinoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-7-methoxy-3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | COCCN1CCc2cc(Nc3ncc(Cl)c(N[C@@H]4CCCC[C@@H]4CNS(=O)O)n3)c(OC)cc2CC1 |
| InChI | InChI=1S/C25H37ClN6O4S/c1-35-12-11-32-9-7-17-13-22(23(36-2)14-18(17)8-10-32)30-25-27-16-20(26)24(31-25)29-21-6-4-3-5-19(21)15-28-37(33)34/h13-14,16,19,21,28H,3-12,15H2,1-2H3,(H,33,34)(H2,27,29,30,31)/t19-,21-/m1/s1 |
| InChIKey | AHTBRMHHZRUSFD-TZIWHRDSSA-N |
| XLogP | 3.63 |
| TPSA | 120.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.13 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|