C25H37ClN7O3S- — CID 118272812
8-[[5-chloro-4-[[(1R,2R)-2-[(sulfinatoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-1,4-diethyl-7-methoxy-3,5-dihydro-2H-1,4-benzodiazepine (PubChem CID 118272812) has the molecular formula C25H37ClN7O3S- and a molecular weight of 551.14 g/mol. Its IUPAC name is 8-[[5-chloro-4-[[(1R,2R)-2-[(sulfinatoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-1,4-diethyl-7-methoxy-3,5-dihydro-2H-1,4-benzodiazepine.
| Compound Name | 8-[[5-chloro-4-[[(1R,2R)-2-[(sulfinatoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-1,4-diethyl-7-methoxy-3,5-dihydro-2H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 118272812 |
| Molecular Formula | C25H37ClN7O3S- |
| Molecular Weight | 551.14 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 8-[[5-chloro-4-[[(1R,2R)-2-[(sulfinatoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-1,4-diethyl-7-methoxy-3,5-dihydro-2H-1,4-benzodiazepine |
| SMILES | CCN1CCN(CC)c2cc(Nc3ncc(Cl)c(N[C@@H]4CCCC[C@@H]4CNS(=O)[O-])n3)c(OC)cc2C1 |
| InChI | InChI=1S/C25H38ClN7O3S/c1-4-32-10-11-33(5-2)22-13-21(23(36-3)12-18(22)16-32)30-25-27-15-19(26)24(31-25)29-20-9-7-6-8-17(20)14-28-37(34)35/h12-13,15,17,20,28H,4-11,14,16H2,1-3H3,(H,34,35)(H2,27,29,30,31)/p-1/t17-,20-/m1/s1 |
| InChIKey | PSZFYXRFCJVGKE-YLJYHZDGSA-M |
| XLogP | 3.90 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.14 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|