C22H29ClN7O3S- — CID 118272970
6-[[5-chloro-4-[[(1R,2R)-2-[(sulfinatoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-1,4-dimethyl-5-oxo-2,3-dihydro-1,4-benzodiazepine (PubChem CID 118272970) has the molecular formula C22H29ClN7O3S- and a molecular weight of 507.04 g/mol. Its IUPAC name is 6-[[5-chloro-4-[[(1R,2R)-2-[(sulfinatoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-1,4-dimethyl-5-oxo-2,3-dihydro-1,4-benzodiazepine.
| Compound Name | 6-[[5-chloro-4-[[(1R,2R)-2-[(sulfinatoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-1,4-dimethyl-5-oxo-2,3-dihydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 118272970 |
| Molecular Formula | C22H29ClN7O3S- |
| Molecular Weight | 507.04 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 6-[[5-chloro-4-[[(1R,2R)-2-[(sulfinatoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-1,4-dimethyl-5-oxo-2,3-dihydro-1,4-benzodiazepine |
| SMILES | CN1CCN(C)c2cccc(Nc3ncc(Cl)c(N[C@@H]4CCCC[C@@H]4CNS(=O)[O-])n3)c2C1=O |
| InChI | InChI=1S/C22H30ClN7O3S/c1-29-10-11-30(2)21(31)19-17(8-5-9-18(19)29)27-22-24-13-15(23)20(28-22)26-16-7-4-3-6-14(16)12-25-34(32)33/h5,8-9,13-14,16,25H,3-4,6-7,10-12H2,1-2H3,(H,32,33)(H2,24,26,27,28)/p-1/t14-,16-/m1/s1 |
| InChIKey | KPVGCNASFWXLCU-GDBMZVCRSA-M |
| XLogP | 2.75 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.04 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|