C27H41ClN6O5S — CID 118272904
8-[[5-chloro-4-[[(1R,2R)-2-[(sulfinoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-3-(1,3-dimethoxypropan-2-yl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 118272904) has the molecular formula C27H41ClN6O5S and a molecular weight of 597.18 g/mol. Its IUPAC name is 8-[[5-chloro-4-[[(1R,2R)-2-[(sulfinoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-3-(1,3-dimethoxypropan-2-yl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 8-[[5-chloro-4-[[(1R,2R)-2-[(sulfinoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-3-(1,3-dimethoxypropan-2-yl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 118272904 |
| Molecular Formula | C27H41ClN6O5S |
| Molecular Weight | 597.18 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | 8-[[5-chloro-4-[[(1R,2R)-2-[(sulfinoamino)methyl]cyclohexyl]amino]pyrimidin-2-yl]amino]-3-(1,3-dimethoxypropan-2-yl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | COCC(COC)N1CCc2cc(Nc3ncc(Cl)c(N[C@@H]4CCCC[C@@H]4CNS(=O)O)n3)c(OC)cc2CC1 |
| InChI | InChI=1S/C27H41ClN6O5S/c1-37-16-21(17-38-2)34-10-8-18-12-24(25(39-3)13-19(18)9-11-34)32-27-29-15-22(28)26(33-27)31-23-7-5-4-6-20(23)14-30-40(35)36/h12-13,15,20-21,23,30H,4-11,14,16-17H2,1-3H3,(H,35,36)(H2,29,31,32,33)/t20-,23-/m1/s1 |
| InChIKey | QKUUKMVWBOMVMR-NFBKMPQASA-N |
| XLogP | 3.64 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|