C22H25FN6OS — CID 25015931
N-[1-[4-[[4-(cyclopropylamino)thieno[3,2-d]pyrimidin-2-yl]amino]-2-fluorophenyl]piperidin-4-yl]acetamide (PubChem CID 25015931) has the molecular formula C22H25FN6OS and a molecular weight of 440.55 g/mol. Its IUPAC name is N-[1-[4-[[4-(cyclopropylamino)thieno[3,2-d]pyrimidin-2-yl]amino]-2-fluorophenyl]piperidin-4-yl]acetamide.
| Compound Name | N-[1-[4-[[4-(cyclopropylamino)thieno[3,2-d]pyrimidin-2-yl]amino]-2-fluorophenyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 25015931 |
| Molecular Formula | C22H25FN6OS |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N-[1-[4-[[4-(cyclopropylamino)thieno[3,2-d]pyrimidin-2-yl]amino]-2-fluorophenyl]piperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1CCN(c2ccc(Nc3nc(NC4CC4)c4sccc4n3)cc2F)CC1 |
| InChI | InChI=1S/C22H25FN6OS/c1-13(30)24-15-6-9-29(10-7-15)19-5-4-16(12-17(19)23)26-22-27-18-8-11-31-20(18)21(28-22)25-14-2-3-14/h4-5,8,11-12,14-15H,2-3,6-7,9-10H2,1H3,(H,24,30)(H2,25,26,27,28) |
| InChIKey | FLDDFQAOZXQTNU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|