About 4-[(2-chlorothieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol
4-[(2-chlorothieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol (PubChem CID 112750276) has the molecular formula C12H14ClN3OS
and a molecular weight of 283.78 g/mol. Its IUPAC name is 4-[(2-chlorothieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[(2-chlorothieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol |
| PubChem CID | 112750276 |
| Molecular Formula | C12H14ClN3OS |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 4-[(2-chlorothieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol |
| SMILES | OC1CCC(Nc2nc(Cl)nc3ccsc23)CC1 |
| InChI | InChI=1S/C12H14ClN3OS/c13-12-15-9-5-6-18-10(9)11(16-12)14-7-1-3-8(17)4-2-7/h5-8,17H,1-4H2,(H,14,15,16) |
| InChIKey | DAXZFZZFPGILQL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2-chlorothieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-chlorothieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol?
The IUPAC name of 4-[(2-chlorothieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol (CID 112750276) is 4-[(2-chlorothieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol.
What is the SMILES notation for 4-[(2-chlorothieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol?
The canonical SMILES for 4-[(2-chlorothieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol is OC1CCC(Nc2nc(Cl)nc3ccsc23)CC1.
What is the InChIKey of 4-[(2-chlorothieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol?
The InChIKey is DAXZFZZFPGILQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN3OS/c13-12-15-9-5-6-18-10(9)11(16-12)14-7-1-3-8(17)4-2-7/h5-8,17H,1-4H2,(H,14,15,16).
What are the key properties of 4-[(2-chlorothieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol?
4-[(2-chlorothieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol has a molecular weight of 283.78 g/mol, XLogP of 3.06, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-chlorothieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol is sourced from PubChem (CID 112750276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).