C26H35N5OS — CID 158611356
4-[[2-[[4-[methyl-(1-methylpiperidin-4-yl)amino]phenyl]methyl]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 158611356) has the molecular formula C26H35N5OS and a molecular weight of 465.67 g/mol. Its IUPAC name is 4-[[2-[[4-[methyl-(1-methylpiperidin-4-yl)amino]phenyl]methyl]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[2-[[4-[methyl-(1-methylpiperidin-4-yl)amino]phenyl]methyl]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 158611356 |
| Molecular Formula | C26H35N5OS |
| Molecular Weight | 465.67 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | 4-[[2-[[4-[methyl-(1-methylpiperidin-4-yl)amino]phenyl]methyl]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | CN1CCC(N(C)c2ccc(Cc3nc(NC4CCC(O)CC4)c4sccc4n3)cc2)CC1 |
| InChI | InChI=1S/C26H35N5OS/c1-30-14-11-21(12-15-30)31(2)20-7-3-18(4-8-20)17-24-28-23-13-16-33-25(23)26(29-24)27-19-5-9-22(32)10-6-19/h3-4,7-8,13,16,19,21-22,32H,5-6,9-12,14-15,17H2,1-2H3,(H,27,28,29) |
| InChIKey | MYIVWRUMMMAAML-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|