C24H35N7O2 — CID 142050215
butyl N-[1-[4-[[5-amino-4-(cyclopentylamino)pyrimidin-2-yl]amino]phenyl]pyrrolidin-3-yl]carbamate (PubChem CID 142050215) has the molecular formula C24H35N7O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is butyl N-[1-[4-[[5-amino-4-(cyclopentylamino)pyrimidin-2-yl]amino]phenyl]pyrrolidin-3-yl]carbamate.
| Compound Name | butyl N-[1-[4-[[5-amino-4-(cyclopentylamino)pyrimidin-2-yl]amino]phenyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 142050215 |
| Molecular Formula | C24H35N7O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | butyl N-[1-[4-[[5-amino-4-(cyclopentylamino)pyrimidin-2-yl]amino]phenyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCCCOC(=O)NC1CCN(c2ccc(Nc3ncc(N)c(NC4CCCC4)n3)cc2)C1 |
| InChI | InChI=1S/C24H35N7O2/c1-2-3-14-33-24(32)29-19-12-13-31(16-19)20-10-8-18(9-11-20)28-23-26-15-21(25)22(30-23)27-17-6-4-5-7-17/h8-11,15,17,19H,2-7,12-14,16,25H2,1H3,(H,29,32)(H2,26,27,28,30) |
| InChIKey | SGFSZGKZNDBNII-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|