C29H36N6O2 — CID 169158059
N-[2-[4-(4-cyclopropylpiperazin-1-yl)anilino]quinazolin-8-yl]-4-methoxycyclohexane-1-carboxamide (PubChem CID 169158059) has the molecular formula C29H36N6O2 and a molecular weight of 500.65 g/mol. Its IUPAC name is N-[2-[4-(4-cyclopropylpiperazin-1-yl)anilino]quinazolin-8-yl]-4-methoxycyclohexane-1-carboxamide.
| Compound Name | N-[2-[4-(4-cyclopropylpiperazin-1-yl)anilino]quinazolin-8-yl]-4-methoxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 169158059 |
| Molecular Formula | C29H36N6O2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | N-[2-[4-(4-cyclopropylpiperazin-1-yl)anilino]quinazolin-8-yl]-4-methoxycyclohexane-1-carboxamide |
| SMILES | COC1CCC(C(=O)Nc2cccc3cnc(Nc4ccc(N5CCN(C6CC6)CC5)cc4)nc23)CC1 |
| InChI | InChI=1S/C29H36N6O2/c1-37-25-13-5-20(6-14-25)28(36)32-26-4-2-3-21-19-30-29(33-27(21)26)31-22-7-9-23(10-8-22)34-15-17-35(18-16-34)24-11-12-24/h2-4,7-10,19-20,24-25H,5-6,11-18H2,1H3,(H,32,36)(H,30,31,33) |
| InChIKey | PATBEBITVIPRBD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|