C29H32N6O — CID 141466474
1-[4-[3-[[8-(4-propylanilino)quinazolin-2-yl]amino]phenyl]piperazin-1-yl]ethanone (PubChem CID 141466474) has the molecular formula C29H32N6O and a molecular weight of 480.62 g/mol. Its IUPAC name is 1-[4-[3-[[8-(4-propylanilino)quinazolin-2-yl]amino]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[3-[[8-(4-propylanilino)quinazolin-2-yl]amino]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 141466474 |
| Molecular Formula | C29H32N6O |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 1-[4-[3-[[8-(4-propylanilino)quinazolin-2-yl]amino]phenyl]piperazin-1-yl]ethanone |
| SMILES | CCCc1ccc(Nc2cccc3cnc(Nc4cccc(N5CCN(C(C)=O)CC5)c4)nc23)cc1 |
| InChI | InChI=1S/C29H32N6O/c1-3-6-22-11-13-24(14-12-22)31-27-10-4-7-23-20-30-29(33-28(23)27)32-25-8-5-9-26(19-25)35-17-15-34(16-18-35)21(2)36/h4-5,7-14,19-20,31H,3,6,15-18H2,1-2H3,(H,30,32,33) |
| InChIKey | NHKTVJHQUFMBAU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |