C32H34FN7O2 — CID 123768917
N-[3-[2-[4-(4-acetylpiperazin-1-yl)anilino]quinazolin-8-yl]-2-fluorophenyl]-4-(dimethylamino)but-2-enamide (PubChem CID 123768917) has the molecular formula C32H34FN7O2 and a molecular weight of 567.67 g/mol. Its IUPAC name is N-[3-[2-[4-(4-acetylpiperazin-1-yl)anilino]quinazolin-8-yl]-2-fluorophenyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | N-[3-[2-[4-(4-acetylpiperazin-1-yl)anilino]quinazolin-8-yl]-2-fluorophenyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 123768917 |
| Molecular Formula | C32H34FN7O2 |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | N-[3-[2-[4-(4-acetylpiperazin-1-yl)anilino]quinazolin-8-yl]-2-fluorophenyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CC(=O)N1CCN(c2ccc(Nc3ncc4cccc(-c5cccc(NC(=O)C=CCN(C)C)c5F)c4n3)cc2)CC1 |
| InChI | InChI=1S/C32H34FN7O2/c1-22(41)39-17-19-40(20-18-39)25-14-12-24(13-15-25)35-32-34-21-23-7-4-9-27(31(23)37-32)26-8-5-10-28(30(26)33)36-29(42)11-6-16-38(2)3/h4-15,21H,16-20H2,1-3H3,(H,36,42)(H,34,35,37) |
| InChIKey | RQDWQWOEWVFWGL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|